C36H34IrN5O — CID 140637801
CID 140637801 (PubChem CID 140637801) has the molecular formula C36H34IrN5O and a molecular weight of 744.92 g/mol.
| Compound Name | CID 140637801 |
|---|---|
| PubChem CID | 140637801 |
| Molecular Formula | C36H34IrN5O |
| Molecular Weight | 744.92 g/mol |
| Exact Mass | 745.24 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.CN1[CH-]N(c2[c-]ccc3c2oc2ccccc23)C=N1.[Ir+3] |
| InChI | InChI=1S/C21H23N2.C15H11N3O.Ir/c1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;1-17-10-18(9-16-17)13-7-4-6-12-11-5-2-3-8-14(11)19-15(12)13;/h5-9,11-16H,1-4H3;2-6,8-10H,1H3;/q-1;-2;+3 |
| InChIKey | QLVQJOOKZIUGQU-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 49.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.92 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|