C44H43IrN6 — CID 140637879
CID 140637879 (PubChem CID 140637879) has the molecular formula C44H43IrN6 and a molecular weight of 848.09 g/mol.
| Compound Name | CID 140637879 |
|---|---|
| PubChem CID | 140637879 |
| Molecular Formula | C44H43IrN6 |
| Molecular Weight | 848.09 g/mol |
| Exact Mass | 848.32 |
| IUPAC Name | — |
| SMILES | CC(C)N1C=NN(c2[c-]ccc3c4ccccc4n(-c4ccccc4)c23)[CH-]1.CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.[Ir+3] |
| InChI | InChI=1S/C23H20N4.C21H23N2.Ir/c1-17(2)25-15-24-26(16-25)22-14-8-12-20-19-11-6-7-13-21(19)27(23(20)22)18-9-4-3-5-10-18;1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;/h3-13,15-17H,1-2H3;5-9,11-16H,1-4H3;/q-2;-1;+3 |
| InChIKey | GPJGRMLDBDTTGM-UHFFFAOYSA-N |
| XLogP | 10.76 |
| TPSA | 41.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.09 |
| LogP ≤ 5 | 10.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|