C33H33IrN6 — CID 58556384
1-[2,6-di(propan-2-yl)phenyl]-2-phenylimidazole;iridium(3+);9-methyl-7-phenyl-8H-purin-8-ide (PubChem CID 58556384) has the molecular formula C33H33IrN6 and a molecular weight of 705.89 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2-phenylimidazole;iridium(3+);9-methyl-7-phenyl-8H-purin-8-ide.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2-phenylimidazole;iridium(3+);9-methyl-7-phenyl-8H-purin-8-ide |
|---|---|
| PubChem CID | 58556384 |
| Molecular Formula | C33H33IrN6 |
| Molecular Weight | 705.89 g/mol |
| Exact Mass | 706.24 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2-phenylimidazole;iridium(3+);9-methyl-7-phenyl-8H-purin-8-ide |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.CN1[CH-]N(c2[c-]cccc2)c2cncnc21.[Ir+3] |
| InChI | InChI=1S/C21H23N2.C12H10N4.Ir/c1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;1-15-9-16(10-5-3-2-4-6-10)11-7-13-8-14-12(11)15;/h5-9,11-16H,1-4H3;2-5,7-9H,1H3;/q-1;-2;+3 |
| InChIKey | GPXVAUUYCAUPHD-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.89 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|