C38H39IrN4S — CID 162494045
CID 162494045 (PubChem CID 162494045) has the molecular formula C38H39IrN4S and a molecular weight of 776.04 g/mol.
| Compound Name | CID 162494045 |
|---|---|
| PubChem CID | 162494045 |
| Molecular Formula | C38H39IrN4S |
| Molecular Weight | 776.04 g/mol |
| Exact Mass | 776.25 |
| IUPAC Name | — |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1ccnc1-c1[c-]cccc1.CN1[CH-]N2c3c([S-])cccc3C(C)(C)c3cccc1c32.[Ir+3] |
| InChI | InChI=1S/C21H23N2.C17H17N2S.Ir/c1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;1-17(2)11-6-4-8-13-15(11)19(10-18(13)3)16-12(17)7-5-9-14(16)20;/h5-9,11-16H,1-4H3;4-10,20H,1-3H3;/q2*-1;+3/p-1 |
| InChIKey | MLHNQAUCTFUMJM-UHFFFAOYSA-M |
| XLogP | 9.52 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.04 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|