C21H23IrN2- — CID 59546936
1-[2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenyl]-2-phenylimidazole;iridium (PubChem CID 59546936) has the molecular formula C21H23IrN2- and a molecular weight of 509.73 g/mol. Its IUPAC name is 1-[2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenyl]-2-phenylimidazole;iridium.
| Compound Name | 1-[2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenyl]-2-phenylimidazole;iridium |
|---|---|
| PubChem CID | 59546936 |
| Molecular Formula | C21H23IrN2- |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | 1-[2,6-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)phenyl]-2-phenylimidazole;iridium |
| SMILES | [2H]C([2H])([2H])C([2H])(c1cccc(C([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H])c1-n1ccnc1-c1[c-]cccc1)C([2H])([2H])[2H].[Ir] |
| InChI | InChI=1S/C21H23N2.Ir/c1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17;/h5-9,11-16H,1-4H3;/q-1;/i1D3,2D3,3D3,4D3,15D,16D; |
| InChIKey | JXBBSWZZOBZVOP-WYLPCRNDSA-N |
| XLogP | 5.58 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|