About iridium;1-naphthalen-1-yl-2-phenylimidazole
iridium;1-naphthalen-1-yl-2-phenylimidazole (PubChem CID 58113418) has the molecular formula C19H13IrN2-
and a molecular weight of 461.54 g/mol. Its IUPAC name is iridium;1-naphthalen-1-yl-2-phenylimidazole.
Molecular Properties
| Compound Name | iridium;1-naphthalen-1-yl-2-phenylimidazole |
| PubChem CID | 58113418 |
| Molecular Formula | C19H13IrN2- |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | iridium;1-naphthalen-1-yl-2-phenylimidazole |
| SMILES | [Ir].[c-]1ccccc1-c1nccn1-c1cccc2ccccc12 |
| InChI | InChI=1S/C19H13N2.Ir/c1-2-8-16(9-3-1)19-20-13-14-21(19)18-12-6-10-15-7-4-5-11-17(15)18;/h1-8,10-14H;/q-1; |
| InChIKey | QUOBVQZRWUFJNB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-naphthalen-1-yl-2-phenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-naphthalen-1-yl-2-phenylimidazole?
The IUPAC name of iridium;1-naphthalen-1-yl-2-phenylimidazole (CID 58113418) is iridium;1-naphthalen-1-yl-2-phenylimidazole.
What is the SMILES notation for iridium;1-naphthalen-1-yl-2-phenylimidazole?
The canonical SMILES for iridium;1-naphthalen-1-yl-2-phenylimidazole is [Ir].[c-]1ccccc1-c1nccn1-c1cccc2ccccc12.
What is the InChIKey of iridium;1-naphthalen-1-yl-2-phenylimidazole?
The InChIKey is QUOBVQZRWUFJNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13N2.Ir/c1-2-8-16(9-3-1)19-20-13-14-21(19)18-12-6-10-15-7-4-5-11-17(15)18;/h1-8,10-14H;/q-1;.
What are the key properties of iridium;1-naphthalen-1-yl-2-phenylimidazole?
iridium;1-naphthalen-1-yl-2-phenylimidazole has a molecular weight of 461.54 g/mol, XLogP of 4.49, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-naphthalen-1-yl-2-phenylimidazole is sourced from PubChem (CID 58113418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).