C20H19IrN2O4- — CID 153499828
iridium;oxalic acid;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole (PubChem CID 153499828) has the molecular formula C20H19IrN2O4- and a molecular weight of 543.60 g/mol. Its IUPAC name is iridium;oxalic acid;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole.
| Compound Name | iridium;oxalic acid;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
|---|---|
| PubChem CID | 153499828 |
| Molecular Formula | C20H19IrN2O4- |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 544.10 |
| IUPAC Name | iridium;oxalic acid;2-phenyl-1-(2,4,6-trimethylphenyl)imidazole |
| SMILES | Cc1cc(C)c(-n2ccnc2-c2[c-]cccc2)c(C)c1.O=C(O)C(=O)O.[Ir] |
| InChI | InChI=1S/C18H17N2.C2H2O4.Ir/c1-13-11-14(2)17(15(3)12-13)20-10-9-19-18(20)16-7-5-4-6-8-16;3-1(4)2(5)6;/h4-7,9-12H,1-3H3;(H,3,4)(H,5,6);/q-1;; |
| InChIKey | XSZJRUBIOWMWIQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|