About iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole
iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole (PubChem CID 58947288) has the molecular formula C19H16IrN3-
and a molecular weight of 478.58 g/mol. Its IUPAC name is iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole.
Molecular Properties
| Compound Name | iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole |
| PubChem CID | 58947288 |
| Molecular Formula | C19H16IrN3- |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole |
| SMILES | [C-]#[N+]c1cc[c-]c(-c2nccn2-c2c(C)cc(C)cc2C)c1.[Ir] |
| InChI | InChI=1S/C19H16N3.Ir/c1-13-10-14(2)18(15(3)11-13)22-9-8-21-19(22)16-6-5-7-17(12-16)20-4;/h5,7-12H,1-3H3;/q-1; |
| InChIKey | KJAXPUXSTDHWJX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole?
The IUPAC name of iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole (CID 58947288) is iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole.
What is the SMILES notation for iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole?
The canonical SMILES for iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole is [C-]#[N+]c1cc[c-]c(-c2nccn2-c2c(C)cc(C)cc2C)c1.[Ir].
What is the InChIKey of iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole?
The InChIKey is KJAXPUXSTDHWJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N3.Ir/c1-13-10-14(2)18(15(3)11-13)22-9-8-21-19(22)16-6-5-7-17(12-16)20-4;/h5,7-12H,1-3H3;/q-1;.
What are the key properties of iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole?
iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole has a molecular weight of 478.58 g/mol, XLogP of 4.81, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;2-(3-isocyanobenzene-6-id-1-yl)-1-(2,4,6-trimethylphenyl)imidazole is sourced from PubChem (CID 58947288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).