C24H20IrN3- — CID 159668232
deuterium monohydride;1-(2,6-dimethyl-4-phenylphenyl)-2-(3-isocyanobenzene-6-id-1-yl)imidazole;iridium (PubChem CID 159668232) has the molecular formula C24H20IrN3- and a molecular weight of 543.67 g/mol. Its IUPAC name is deuterium monohydride;1-(2,6-dimethyl-4-phenylphenyl)-2-(3-isocyanobenzene-6-id-1-yl)imidazole;iridium.
| Compound Name | deuterium monohydride;1-(2,6-dimethyl-4-phenylphenyl)-2-(3-isocyanobenzene-6-id-1-yl)imidazole;iridium |
|---|---|
| PubChem CID | 159668232 |
| Molecular Formula | C24H20IrN3- |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 544.14 |
| IUPAC Name | deuterium monohydride;1-(2,6-dimethyl-4-phenylphenyl)-2-(3-isocyanobenzene-6-id-1-yl)imidazole;iridium |
| SMILES | [C-]#[N+]c1cc[c-]c(-c2nccn2-c2c(C)cc(-c3ccccc3)cc2C)c1.[H][2H].[Ir] |
| InChI | InChI=1S/C24H18N3.Ir.H2/c1-17-14-21(19-8-5-4-6-9-19)15-18(2)23(17)27-13-12-26-24(27)20-10-7-11-22(16-20)25-3;;/h4-9,11-16H,1-2H3;;1H/q-1;;/i;;1+1 |
| InChIKey | BVQYTUNTYCBZOI-FCHARDOESA-N |
| XLogP | 6.42 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|