C29H20IrN3- — CID 158751938
4,5-dideuterio-2-(3-isocyanobenzene-6-id-1-yl)-1-(4-methyl-2,6-diphenylphenyl)imidazole;iridium (PubChem CID 158751938) has the molecular formula C29H20IrN3- and a molecular weight of 604.73 g/mol. Its IUPAC name is 4,5-dideuterio-2-(3-isocyanobenzene-6-id-1-yl)-1-(4-methyl-2,6-diphenylphenyl)imidazole;iridium.
| Compound Name | 4,5-dideuterio-2-(3-isocyanobenzene-6-id-1-yl)-1-(4-methyl-2,6-diphenylphenyl)imidazole;iridium |
|---|---|
| PubChem CID | 158751938 |
| Molecular Formula | C29H20IrN3- |
| Molecular Weight | 604.73 g/mol |
| Exact Mass | 605.14 |
| IUPAC Name | 4,5-dideuterio-2-(3-isocyanobenzene-6-id-1-yl)-1-(4-methyl-2,6-diphenylphenyl)imidazole;iridium |
| SMILES | [2H]c1nc(-c2[c-]ccc([N+]#[C-])c2)n(-c2c(-c3ccccc3)cc(C)cc2-c2ccccc2)c1[2H].[Ir] |
| InChI | InChI=1S/C29H20N3.Ir/c1-21-18-26(22-10-5-3-6-11-22)28(27(19-21)23-12-7-4-8-13-23)32-17-16-31-29(32)24-14-9-15-25(20-24)30-2;/h3-13,15-20H,1H3;/q-1;/i16D,17D; |
| InChIKey | OVLNVATWVFNUBD-KPOZQMHMSA-N |
| XLogP | 7.53 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|