C18H11IrN2- — CID 58401094
iridium;2-[3-(3-isocyanophenyl)benzene-6-id-1-yl]pyridine (PubChem CID 58401094) has the molecular formula C18H11IrN2- and a molecular weight of 447.52 g/mol. Its IUPAC name is iridium;2-[3-(3-isocyanophenyl)benzene-6-id-1-yl]pyridine.
| Compound Name | iridium;2-[3-(3-isocyanophenyl)benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 58401094 |
| Molecular Formula | C18H11IrN2- |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | iridium;2-[3-(3-isocyanophenyl)benzene-6-id-1-yl]pyridine |
| SMILES | [C-]#[N+]c1cccc(-c2cc[c-]c(-c3ccccn3)c2)c1.[Ir] |
| InChI | InChI=1S/C18H11N2.Ir/c1-19-17-9-5-7-15(13-17)14-6-4-8-16(12-14)18-10-2-3-11-20-18;/h2-7,9-13H;/q-1; |
| InChIKey | CKZSMJXQEIWBOJ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|