C83H56IrN- — CID 153429636
iridium;4-(2,3,4,5,6-pentakis-phenylphenyl)-2-[3-(2,3,4,5,6-pentakis-phenylphenyl)benzene-6-id-1-yl]pyridine (PubChem CID 153429636) has the molecular formula C83H56IrN- and a molecular weight of 1259.59 g/mol. Its IUPAC name is iridium;4-(2,3,4,5,6-pentakis-phenylphenyl)-2-[3-(2,3,4,5,6-pentakis-phenylphenyl)benzene-6-id-1-yl]pyridine.
| Compound Name | iridium;4-(2,3,4,5,6-pentakis-phenylphenyl)-2-[3-(2,3,4,5,6-pentakis-phenylphenyl)benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 153429636 |
| Molecular Formula | C83H56IrN- |
| Molecular Weight | 1259.59 g/mol |
| Exact Mass | 1259.40 |
| IUPAC Name | iridium;4-(2,3,4,5,6-pentakis-phenylphenyl)-2-[3-(2,3,4,5,6-pentakis-phenylphenyl)benzene-6-id-1-yl]pyridine |
| SMILES | [Ir].[c-]1ccc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)cc1-c1cc(-c2c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c2-c2ccccc2)ccn1 |
| InChI | InChI=1S/C83H56N.Ir/c1-11-32-58(33-12-1)72-74(60-36-15-3-16-37-60)78(64-44-23-7-24-45-64)82(79(65-46-25-8-26-47-65)75(72)61-38-17-4-18-39-61)69-53-31-52-68(56-69)71-57-70(54-55-84-71)83-80(66-48-27-9-28-49-66)76(62-40-19-5-20-41-62)73(59-34-13-2-14-35-59)77(63-42-21-6-22-43-63)81(83)67-50-29-10-30-51-67;/h1-51,53-57H;/q-1; |
| InChIKey | JJCIZBAFUCGTLC-UHFFFAOYSA-N |
| XLogP | 22.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 85 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1259.59 |
| LogP ≤ 5 | 22.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|