C17H10F2IrN- — CID 58658159
2-[3-(3,5-difluorophenyl)benzene-6-id-1-yl]pyridine;iridium (PubChem CID 58658159) has the molecular formula C17H10F2IrN- and a molecular weight of 458.49 g/mol. Its IUPAC name is 2-[3-(3,5-difluorophenyl)benzene-6-id-1-yl]pyridine;iridium.
| Compound Name | 2-[3-(3,5-difluorophenyl)benzene-6-id-1-yl]pyridine;iridium |
|---|---|
| PubChem CID | 58658159 |
| Molecular Formula | C17H10F2IrN- |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 459.04 |
| IUPAC Name | 2-[3-(3,5-difluorophenyl)benzene-6-id-1-yl]pyridine;iridium |
| SMILES | Fc1cc(F)cc(-c2cc[c-]c(-c3ccccn3)c2)c1.[Ir] |
| InChI | InChI=1S/C17H10F2N.Ir/c18-15-9-14(10-16(19)11-15)12-4-3-5-13(8-12)17-6-1-2-7-20-17;/h1-4,6-11H;/q-1; |
| InChIKey | MZHJDJXGASGDIG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|