C42H36IrN2-2 — CID 140756444
CID 140756444 (PubChem CID 140756444) has the molecular formula C42H36IrN2-2 and a molecular weight of 760.98 g/mol.
| Compound Name | CID 140756444 |
|---|---|
| PubChem CID | 140756444 |
| Molecular Formula | C42H36IrN2-2 |
| Molecular Weight | 760.98 g/mol |
| Exact Mass | 761.25 |
| IUPAC Name | — |
| SMILES | Cc1cccc(C)c1-c1cc[c-]c(-c2ccccn2)c1.[Ir].[c-]1cc2c(cc1-c1cc(-c3ccccc3)ccn1)C1CCC2CC1 |
| InChI | InChI=1S/C23H20N.C19H16N.Ir/c1-2-4-16(5-3-1)19-12-13-24-23(15-19)20-10-11-21-17-6-8-18(9-7-17)22(21)14-20;1-14-7-5-8-15(2)19(14)17-10-6-9-16(13-17)18-11-3-4-12-20-18;/h1-5,11-15,17-18H,6-9H2;3-8,10-13H,1-2H3;/q2*-1; |
| InChIKey | PZDOJMKSDKTDSZ-UHFFFAOYSA-N |
| XLogP | 10.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.98 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|