C47H46IrN2-2 — CID 140756470
CID 140756470 (PubChem CID 140756470) has the molecular formula C47H46IrN2-2 and a molecular weight of 831.12 g/mol.
| Compound Name | CID 140756470 |
|---|---|
| PubChem CID | 140756470 |
| Molecular Formula | C47H46IrN2-2 |
| Molecular Weight | 831.12 g/mol |
| Exact Mass | 831.33 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2[c-]cc3c(c2)C2CC4CC(CC3C4)C2)ncc1-c1ccc2c(c1)C1CC3CC(CC2C3)C1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C36H38N.C11H8N.Ir/c1-20-6-36(26-3-5-32-28-11-23-8-24(12-28)16-30(15-23)34(32)18-26)37-19-35(20)25-2-4-31-27-9-21-7-22(10-27)14-29(13-21)33(31)17-25;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h2,4-6,17-19,21-24,27-30H,7-16H2,1H3;1-6,8-9H;/q2*-1; |
| InChIKey | QEVDOSABKDUUEG-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.12 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|