C25H17IrN2- — CID 176849305
iridium;5-(3-isocyanophenyl)-4-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine (PubChem CID 176849305) has the molecular formula C25H17IrN2- and a molecular weight of 537.64 g/mol. Its IUPAC name is iridium;5-(3-isocyanophenyl)-4-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine.
| Compound Name | iridium;5-(3-isocyanophenyl)-4-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 176849305 |
| Molecular Formula | C25H17IrN2- |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | iridium;5-(3-isocyanophenyl)-4-methyl-2-(3-phenylbenzene-6-id-1-yl)pyridine |
| SMILES | [C-]#[N+]c1cccc(-c2cnc(-c3[c-]ccc(-c4ccccc4)c3)cc2C)c1.[Ir] |
| InChI | InChI=1S/C25H17N2.Ir/c1-18-14-25(27-17-24(18)21-11-7-13-23(16-21)26-2)22-12-6-10-20(15-22)19-8-4-3-5-9-19;/h3-11,13-17H,1H3;/q-1; |
| InChIKey | DCRLYCNQLVEUJP-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|