C26H19IrN4- — CID 176849293
9-ethyl-3-[5-(3-isocyanophenyl)-4-methyl-2-pyridinyl]-2H-pyrido[2,3-b]indol-2-ide;iridium (PubChem CID 176849293) has the molecular formula C26H19IrN4- and a molecular weight of 579.68 g/mol. Its IUPAC name is 9-ethyl-3-[5-(3-isocyanophenyl)-4-methyl-2-pyridinyl]-2H-pyrido[2,3-b]indol-2-ide;iridium.
| Compound Name | 9-ethyl-3-[5-(3-isocyanophenyl)-4-methyl-2-pyridinyl]-2H-pyrido[2,3-b]indol-2-ide;iridium |
|---|---|
| PubChem CID | 176849293 |
| Molecular Formula | C26H19IrN4- |
| Molecular Weight | 579.68 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | 9-ethyl-3-[5-(3-isocyanophenyl)-4-methyl-2-pyridinyl]-2H-pyrido[2,3-b]indol-2-ide;iridium |
| SMILES | [C-]#[N+]c1cccc(-c2cnc(-c3[c-]nc4c(c3)c3ccccc3n4CC)cc2C)c1.[Ir] |
| InChI | InChI=1S/C26H19N4.Ir/c1-4-30-25-11-6-5-10-21(25)22-14-19(15-29-26(22)30)24-12-17(2)23(16-28-24)18-8-7-9-20(13-18)27-3;/h5-14,16H,4H2,1-2H3;/q-1; |
| InChIKey | JNJSDMMBKCHKOP-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 35.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.68 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|