C20H21N3 — CID 140813436
5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine (PubChem CID 140813436) has the molecular formula C20H21N3 and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine.
| Compound Name | 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 140813436 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine |
| SMILES | [C-]#[N+]c1cccc(-c2cc3c(C)c(C)n(CC(C)C)c3cn2)c1 |
| InChI | InChI=1S/C20H21N3/c1-13(2)12-23-15(4)14(3)18-10-19(22-11-20(18)23)16-7-6-8-17(9-16)21-5/h6-11,13H,12H2,1-4H3 |
| InChIKey | ZQWSMSQZOZEZID-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|