About 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine
5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine (PubChem CID 140813436) has the molecular formula C20H21N3
and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine |
| PubChem CID | 140813436 |
| Molecular Formula | C20H21N3 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine |
| SMILES | [C-]#[N+]c1cccc(-c2cc3c(C)c(C)n(CC(C)C)c3cn2)c1 |
| InChI | InChI=1S/C20H21N3/c1-13(2)12-23-15(4)14(3)18-10-19(22-11-20(18)23)16-7-6-8-17(9-16)21-5/h6-11,13H,12H2,1-4H3 |
| InChIKey | ZQWSMSQZOZEZID-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 22.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine?
The IUPAC name of 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine (CID 140813436) is 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine.
What is the SMILES notation for 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine?
The canonical SMILES for 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine is [C-]#[N+]c1cccc(-c2cc3c(C)c(C)n(CC(C)C)c3cn2)c1.
What is the InChIKey of 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine?
The InChIKey is ZQWSMSQZOZEZID-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3/c1-13(2)12-23-15(4)14(3)18-10-19(22-11-20(18)23)16-7-6-8-17(9-16)21-5/h6-11,13H,12H2,1-4H3.
What are the key properties of 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine?
5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine has a molecular weight of 303.41 g/mol, XLogP of 5.53, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-isocyanophenyl)-2,3-dimethyl-1-(2-methylpropyl)pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 140813436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).