C16H14ClFN2 — CID 141136075
5-chloro-1-[(3-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine (PubChem CID 141136075) has the molecular formula C16H14ClFN2 and a molecular weight of 288.75 g/mol. Its IUPAC name is 5-chloro-1-[(3-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine.
| Compound Name | 5-chloro-1-[(3-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 141136075 |
| Molecular Formula | C16H14ClFN2 |
| Molecular Weight | 288.75 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 5-chloro-1-[(3-fluorophenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine |
| SMILES | Cc1c(C)n(Cc2cccc(F)c2)c2cnc(Cl)cc12 |
| InChI | InChI=1S/C16H14ClFN2/c1-10-11(2)20(9-12-4-3-5-13(18)6-12)15-8-19-16(17)7-14(10)15/h3-8H,9H2,1-2H3 |
| InChIKey | XRDXEHLVEXAENX-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.75 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|