C24H19ClFN3O — CID 11495445
3-[[5-chloro-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[2,3-c]pyridin-1-yl]methyl]benzonitrile (PubChem CID 11495445) has the molecular formula C24H19ClFN3O and a molecular weight of 419.89 g/mol. Its IUPAC name is 3-[[5-chloro-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[2,3-c]pyridin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[5-chloro-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[2,3-c]pyridin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 11495445 |
| Molecular Formula | C24H19ClFN3O |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 3-[[5-chloro-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[2,3-c]pyridin-1-yl]methyl]benzonitrile |
| SMILES | Cc1c(C)n(Cc2cccc(C#N)c2)c2c(OCc3ccc(F)cc3)nc(Cl)cc12 |
| InChI | InChI=1S/C24H19ClFN3O/c1-15-16(2)29(13-19-5-3-4-18(10-19)12-27)23-21(15)11-22(25)28-24(23)30-14-17-6-8-20(26)9-7-17/h3-11H,13-14H2,1-2H3 |
| InChIKey | NWBWUFZLKBZJFU-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|