C20H20ClFN2O — CID 11617419
5-chloro-1-(cyclopropylmethyl)-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[2,3-c]pyridine (PubChem CID 11617419) has the molecular formula C20H20ClFN2O and a molecular weight of 358.84 g/mol. Its IUPAC name is 5-chloro-1-(cyclopropylmethyl)-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[2,3-c]pyridine.
| Compound Name | 5-chloro-1-(cyclopropylmethyl)-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 11617419 |
| Molecular Formula | C20H20ClFN2O |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 5-chloro-1-(cyclopropylmethyl)-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[2,3-c]pyridine |
| SMILES | Cc1c(C)n(CC2CC2)c2c(OCc3ccc(F)cc3)nc(Cl)cc12 |
| InChI | InChI=1S/C20H20ClFN2O/c1-12-13(2)24(10-14-3-4-14)19-17(12)9-18(21)23-20(19)25-11-15-5-7-16(22)8-6-15/h5-9,14H,3-4,10-11H2,1-2H3 |
| InChIKey | MWOUSUGQYPLKRN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|