C24H22ClFN2O2 — CID 11640443
5-chloro-7-[(4-fluorophenyl)methoxy]-1-[(3-methoxyphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine (PubChem CID 11640443) has the molecular formula C24H22ClFN2O2 and a molecular weight of 424.90 g/mol. Its IUPAC name is 5-chloro-7-[(4-fluorophenyl)methoxy]-1-[(3-methoxyphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine.
| Compound Name | 5-chloro-7-[(4-fluorophenyl)methoxy]-1-[(3-methoxyphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 11640443 |
| Molecular Formula | C24H22ClFN2O2 |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 5-chloro-7-[(4-fluorophenyl)methoxy]-1-[(3-methoxyphenyl)methyl]-2,3-dimethylpyrrolo[2,3-c]pyridine |
| SMILES | COc1cccc(Cn2c(C)c(C)c3cc(Cl)nc(OCc4ccc(F)cc4)c32)c1 |
| InChI | InChI=1S/C24H22ClFN2O2/c1-15-16(2)28(13-18-5-4-6-20(11-18)29-3)23-21(15)12-22(25)27-24(23)30-14-17-7-9-19(26)10-8-17/h4-12H,13-14H2,1-3H3 |
| InChIKey | FRMICVDYDONLAF-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|