About 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid
1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid (PubChem CID 68701294) has the molecular formula C24H21FN2O3
and a molecular weight of 404.44 g/mol. Its IUPAC name is 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid.
Molecular Properties
| Compound Name | 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid |
| PubChem CID | 68701294 |
| Molecular Formula | C24H21FN2O3 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2c(OCc3ccc(F)cc3)c(C(=O)O)cnc12 |
| InChI | InChI=1S/C24H21FN2O3/c1-15-16(2)27(13-17-6-4-3-5-7-17)22-21(15)26-12-20(24(28)29)23(22)30-14-18-8-10-19(25)11-9-18/h3-12H,13-14H2,1-2H3,(H,28,29) |
| InChIKey | ZFJCAEHBZQMBEY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid?
The IUPAC name of 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid (CID 68701294) is 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid.
What is the SMILES notation for 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid?
The canonical SMILES for 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid is Cc1c(C)n(Cc2ccccc2)c2c(OCc3ccc(F)cc3)c(C(=O)O)cnc12.
What is the InChIKey of 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid?
The InChIKey is ZFJCAEHBZQMBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21FN2O3/c1-15-16(2)27(13-17-6-4-3-5-7-17)22-21(15)26-12-20(24(28)29)23(22)30-14-18-8-10-19(25)11-9-18/h3-12H,13-14H2,1-2H3,(H,28,29).
What are the key properties of 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid?
1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid has a molecular weight of 404.44 g/mol, XLogP of 5.12, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-7-[(4-fluorophenyl)methoxy]-2,3-dimethylpyrrolo[3,2-b]pyridine-6-carboxylic acid is sourced from PubChem (CID 68701294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).