C25H20FNO3 — CID 59696278
3-[(4-fluorophenyl)methyl]-7-methyl-8-phenylmethoxyquinoline-5-carboxylic acid (PubChem CID 59696278) has the molecular formula C25H20FNO3 and a molecular weight of 401.44 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-methyl-8-phenylmethoxyquinoline-5-carboxylic acid.
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-methyl-8-phenylmethoxyquinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 59696278 |
| Molecular Formula | C25H20FNO3 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-methyl-8-phenylmethoxyquinoline-5-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c2cc(Cc3ccc(F)cc3)cnc2c1OCc1ccccc1 |
| InChI | InChI=1S/C25H20FNO3/c1-16-11-22(25(28)29)21-13-19(12-17-7-9-20(26)10-8-17)14-27-23(21)24(16)30-15-18-5-3-2-4-6-18/h2-11,13-14H,12,15H2,1H3,(H,28,29) |
| InChIKey | AZLRYYHQJGCGEP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |