C27H23FN4O4 — CID 142873195
methyl 5-(C-ethanimidoyloxycarbonimidoyl)-3-[(4-fluorophenyl)methyl]-8-phenylmethoxy-1,6-naphthyridine-7-carboxylate (PubChem CID 142873195) has the molecular formula C27H23FN4O4 and a molecular weight of 486.50 g/mol. Its IUPAC name is methyl 5-(C-ethanimidoyloxycarbonimidoyl)-3-[(4-fluorophenyl)methyl]-8-phenylmethoxy-1,6-naphthyridine-7-carboxylate.
| Compound Name | methyl 5-(C-ethanimidoyloxycarbonimidoyl)-3-[(4-fluorophenyl)methyl]-8-phenylmethoxy-1,6-naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 142873195 |
| Molecular Formula | C27H23FN4O4 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | methyl 5-(C-ethanimidoyloxycarbonimidoyl)-3-[(4-fluorophenyl)methyl]-8-phenylmethoxy-1,6-naphthyridine-7-carboxylate |
| SMILES | [H]/N=C(\O/C(C)=N/[H])c1nc(C(=O)OC)c(OCc2ccccc2)c2ncc(Cc3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C27H23FN4O4/c1-16(29)36-26(30)23-21-13-19(12-17-8-10-20(28)11-9-17)14-31-22(21)25(24(32-23)27(33)34-2)35-15-18-6-4-3-5-7-18/h3-11,13-14,29-30H,12,15H2,1-2H3/b29-16+,30-26- |
| InChIKey | AOTNFZQIWXDMIH-LPGFTEFSSA-N |
| XLogP | 5.06 |
| TPSA | 118.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|