C17H14N2O3 — CID 59696527
methyl 3-benzyl-8-hydroxy-1,6-naphthyridine-7-carboxylate (PubChem CID 59696527) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is methyl 3-benzyl-8-hydroxy-1,6-naphthyridine-7-carboxylate.
| Compound Name | methyl 3-benzyl-8-hydroxy-1,6-naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 59696527 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | methyl 3-benzyl-8-hydroxy-1,6-naphthyridine-7-carboxylate |
| SMILES | COC(=O)c1ncc2cc(Cc3ccccc3)cnc2c1O |
| InChI | InChI=1S/C17H14N2O3/c1-22-17(21)15-16(20)14-13(10-19-15)8-12(9-18-14)7-11-5-3-2-4-6-11/h2-6,8-10,20H,7H2,1H3 |
| InChIKey | NDXPTBBEKDXNAD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |