C10H8N2O4 — CID 59854199
methyl 3,8-dihydroxy-1,6-naphthyridine-7-carboxylate (PubChem CID 59854199) has the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. Its IUPAC name is methyl 3,8-dihydroxy-1,6-naphthyridine-7-carboxylate.
| Compound Name | methyl 3,8-dihydroxy-1,6-naphthyridine-7-carboxylate |
|---|---|
| PubChem CID | 59854199 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | methyl 3,8-dihydroxy-1,6-naphthyridine-7-carboxylate |
| SMILES | COC(=O)c1ncc2cc(O)cnc2c1O |
| InChI | InChI=1S/C10H8N2O4/c1-16-10(15)8-9(14)7-5(3-11-8)2-6(13)4-12-7/h2-4,13-14H,1H3 |
| InChIKey | MALICGMWNQFZIX-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |