C13H13NO8 — CID 767414
tetramethyl pyridine-2,3,5,6-tetracarboxylate (PubChem CID 767414) has the molecular formula C13H13NO8 and a molecular weight of 311.25 g/mol. Its IUPAC name is tetramethyl pyridine-2,3,5,6-tetracarboxylate.
| Compound Name | tetramethyl pyridine-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 767414 |
| Molecular Formula | C13H13NO8 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | tetramethyl pyridine-2,3,5,6-tetracarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c(C(=O)OC)nc1C(=O)OC |
| InChI | InChI=1S/C13H13NO8/c1-19-10(15)6-5-7(11(16)20-2)9(13(18)22-4)14-8(6)12(17)21-3/h5H,1-4H3 |
| InChIKey | FRNKWNJKUPKZOW-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 118.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|