C16H13N3O4 — CID 10041105
dimethyl 1-phenylpyrazolo[3,4-b]pyridine-5,6-dicarboxylate (PubChem CID 10041105) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is dimethyl 1-phenylpyrazolo[3,4-b]pyridine-5,6-dicarboxylate.
| Compound Name | dimethyl 1-phenylpyrazolo[3,4-b]pyridine-5,6-dicarboxylate |
|---|---|
| PubChem CID | 10041105 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | dimethyl 1-phenylpyrazolo[3,4-b]pyridine-5,6-dicarboxylate |
| SMILES | COC(=O)c1cc2cnn(-c3ccccc3)c2nc1C(=O)OC |
| InChI | InChI=1S/C16H13N3O4/c1-22-15(20)12-8-10-9-17-19(11-6-4-3-5-7-11)14(10)18-13(12)16(21)23-2/h3-9H,1-2H3 |
| InChIKey | TVTBASIUAOHLOY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |