C13H12N2O4 — CID 648745
dimethyl 1-phenylpyrazole-3,4-dicarboxylate (PubChem CID 648745) has the molecular formula C13H12N2O4 and a molecular weight of 260.25 g/mol. Its IUPAC name is dimethyl 1-phenylpyrazole-3,4-dicarboxylate.
| Compound Name | dimethyl 1-phenylpyrazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 648745 |
| Molecular Formula | C13H12N2O4 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | dimethyl 1-phenylpyrazole-3,4-dicarboxylate |
| SMILES | COC(=O)c1cn(-c2ccccc2)nc1C(=O)OC |
| InChI | InChI=1S/C13H12N2O4/c1-18-12(16)10-8-15(9-6-4-3-5-7-9)14-11(10)13(17)19-2/h3-8H,1-2H3 |
| InChIKey | VABYYEHSSHPDRI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |