C21H19N3O6 — CID 7523394
[2-(2-methoxycarbonylanilino)-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate (PubChem CID 7523394) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is [2-(2-methoxycarbonylanilino)-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate.
| Compound Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7523394 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [2-(2-methoxycarbonylanilino)-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
| SMILES | COC(=O)c1ccccc1NC(=O)COC(=O)c1nn(-c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H19N3O6/c1-28-17-12-24(14-8-4-3-5-9-14)23-19(17)21(27)30-13-18(25)22-16-11-7-6-10-15(16)20(26)29-2/h3-12H,13H2,1-2H3,(H,22,25) |
| InChIKey | LKWHUNATPHBADE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |