C18H23N3O4 — CID 7992134
[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate (PubChem CID 7992134) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate.
| Compound Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 7992134 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | [2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
| SMILES | CCC[C@H](C)NC(=O)COC(=O)c1nn(-c2ccccc2)cc1OC |
| InChI | InChI=1S/C18H23N3O4/c1-4-8-13(2)19-16(22)12-25-18(23)17-15(24-3)11-21(20-17)14-9-6-5-7-10-14/h5-7,9-11,13H,4,8,12H2,1-3H3,(H,19,22)/t13-/m0/s1 |
| InChIKey | MCKNZTWLSLIYCB-ZDUSSCGKSA-N |
| XLogP | 2.34 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |