C18H25N3O2 — CID 51862939
4-methoxy-N-[(2S)-5-methylhexan-2-yl]-1-phenylpyrazole-3-carboxamide (PubChem CID 51862939) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-methoxy-N-[(2S)-5-methylhexan-2-yl]-1-phenylpyrazole-3-carboxamide.
| Compound Name | 4-methoxy-N-[(2S)-5-methylhexan-2-yl]-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 51862939 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 4-methoxy-N-[(2S)-5-methylhexan-2-yl]-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)N[C@@H](C)CCC(C)C |
| InChI | InChI=1S/C18H25N3O2/c1-13(2)10-11-14(3)19-18(22)17-16(23-4)12-21(20-17)15-8-6-5-7-9-15/h5-9,12-14H,10-11H2,1-4H3,(H,19,22)/t14-/m0/s1 |
| InChIKey | JZECQQWMKYMBAU-AWEZNQCLSA-N |
| XLogP | 3.44 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |