C20H18ClN3O4 — CID 8703385
[2-(2-chloro-4-methylanilino)-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate (PubChem CID 8703385) has the molecular formula C20H18ClN3O4 and a molecular weight of 399.83 g/mol. Its IUPAC name is [2-(2-chloro-4-methylanilino)-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate.
| Compound Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 8703385 |
| Molecular Formula | C20H18ClN3O4 |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [2-(2-chloro-4-methylanilino)-2-oxoethyl] 4-methoxy-1-phenylpyrazole-3-carboxylate |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)OCC(=O)Nc1ccc(C)cc1Cl |
| InChI | InChI=1S/C20H18ClN3O4/c1-13-8-9-16(15(21)10-13)22-18(25)12-28-20(26)19-17(27-2)11-24(23-19)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H,22,25) |
| InChIKey | HWWZUHKHQULXOZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |