C18H16BrN3O2 — CID 27844853
N-(2-bromo-4-methylphenyl)-4-methoxy-1-phenylpyrazole-3-carboxamide (PubChem CID 27844853) has the molecular formula C18H16BrN3O2 and a molecular weight of 386.25 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-4-methoxy-1-phenylpyrazole-3-carboxamide.
| Compound Name | N-(2-bromo-4-methylphenyl)-4-methoxy-1-phenylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 27844853 |
| Molecular Formula | C18H16BrN3O2 |
| Molecular Weight | 386.25 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-4-methoxy-1-phenylpyrazole-3-carboxamide |
| SMILES | COc1cn(-c2ccccc2)nc1C(=O)Nc1ccc(C)cc1Br |
| InChI | InChI=1S/C18H16BrN3O2/c1-12-8-9-15(14(19)10-12)20-18(23)17-16(24-2)11-22(21-17)13-6-4-3-5-7-13/h3-11H,1-2H3,(H,20,23) |
| InChIKey | KSPKFSUVWOESOU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.25 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |