bromo 4-ethyl-1-phenylpyrazole-3-carboxylate

C12H11BrN2O2 — CID 91569504

IUPACbromo 4-ethyl-1-phenylpyrazole-3-carboxylate
SMILESCCc1cn(-c2ccccc2)nc1C(=O)OBr
InChIInChI=1S/C12H11BrN2O2/c1-2-9-8-15(10-6-4-3-5-7-10)14-11(9)12(16)17-13/h3-8H,2H2,1H3
InChIKeyPHINEARZZYNZJR-UHFFFAOYSA-N
MW295.14 g/mol
LogP2.90
Rot. Bonds3

About bromo 4-ethyl-1-phenylpyrazole-3-carboxylate

bromo 4-ethyl-1-phenylpyrazole-3-carboxylate (PubChem CID 91569504) has the molecular formula C12H11BrN2O2 and a molecular weight of 295.14 g/mol. Its IUPAC name is bromo 4-ethyl-1-phenylpyrazole-3-carboxylate.

Molecular Properties

Compound Namebromo 4-ethyl-1-phenylpyrazole-3-carboxylate
PubChem CID91569504
Molecular FormulaC12H11BrN2O2
Molecular Weight295.14 g/mol
Exact Mass294.00
IUPAC Namebromo 4-ethyl-1-phenylpyrazole-3-carboxylate
SMILESCCc1cn(-c2ccccc2)nc1C(=O)OBr
InChIInChI=1S/C12H11BrN2O2/c1-2-9-8-15(10-6-4-3-5-7-10)14-11(9)12(16)17-13/h3-8H,2H2,1H3
InChIKeyPHINEARZZYNZJR-UHFFFAOYSA-N
XLogP2.90
TPSA44.12 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.14
LogP ≤ 52.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze bromo 4-ethyl-1-phenylpyrazole-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bromo 4-ethyl-1-phenylpyrazole-3-carboxylate?
The IUPAC name of bromo 4-ethyl-1-phenylpyrazole-3-carboxylate (CID 91569504) is bromo 4-ethyl-1-phenylpyrazole-3-carboxylate.
What is the SMILES notation for bromo 4-ethyl-1-phenylpyrazole-3-carboxylate?
The canonical SMILES for bromo 4-ethyl-1-phenylpyrazole-3-carboxylate is CCc1cn(-c2ccccc2)nc1C(=O)OBr.
What is the InChIKey of bromo 4-ethyl-1-phenylpyrazole-3-carboxylate?
The InChIKey is PHINEARZZYNZJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrN2O2/c1-2-9-8-15(10-6-4-3-5-7-10)14-11(9)12(16)17-13/h3-8H,2H2,1H3.
What are the key properties of bromo 4-ethyl-1-phenylpyrazole-3-carboxylate?
bromo 4-ethyl-1-phenylpyrazole-3-carboxylate has a molecular weight of 295.14 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bromo 4-ethyl-1-phenylpyrazole-3-carboxylate is sourced from PubChem (CID 91569504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).