C13H11F3N2O3 — CID 175260189
ethyl 1-phenyl-4-(trifluoromethoxy)pyrazole-3-carboxylate (PubChem CID 175260189) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is ethyl 1-phenyl-4-(trifluoromethoxy)pyrazole-3-carboxylate.
| Compound Name | ethyl 1-phenyl-4-(trifluoromethoxy)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 175260189 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | ethyl 1-phenyl-4-(trifluoromethoxy)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)cc1OC(F)(F)F |
| InChI | InChI=1S/C13H11F3N2O3/c1-2-20-12(19)11-10(21-13(14,15)16)8-18(17-11)9-6-4-3-5-7-9/h3-8H,2H2,1H3 |
| InChIKey | BAUCLWSLBUCGMK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |