C17H15ClN2O3S — CID 55868050
ethyl 4-[(5-chlorothiophen-2-yl)methoxy]-1-phenylpyrazole-3-carboxylate (PubChem CID 55868050) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is ethyl 4-[(5-chlorothiophen-2-yl)methoxy]-1-phenylpyrazole-3-carboxylate.
| Compound Name | ethyl 4-[(5-chlorothiophen-2-yl)methoxy]-1-phenylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55868050 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | ethyl 4-[(5-chlorothiophen-2-yl)methoxy]-1-phenylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)cc1OCc1ccc(Cl)s1 |
| InChI | InChI=1S/C17H15ClN2O3S/c1-2-22-17(21)16-14(23-11-13-8-9-15(18)24-13)10-20(19-16)12-6-4-3-5-7-12/h3-10H,2,11H2,1H3 |
| InChIKey | HXXUVJHLUDNXDW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |