C12H10ClNO3S — CID 79156847
3-[(5-chlorothiophen-2-yl)methoxy]-6-methylpyridine-2-carboxylic acid (PubChem CID 79156847) has the molecular formula C12H10ClNO3S and a molecular weight of 283.74 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)methoxy]-6-methylpyridine-2-carboxylic acid.
| Compound Name | 3-[(5-chlorothiophen-2-yl)methoxy]-6-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 79156847 |
| Molecular Formula | C12H10ClNO3S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)methoxy]-6-methylpyridine-2-carboxylic acid |
| SMILES | Cc1ccc(OCc2ccc(Cl)s2)c(C(=O)O)n1 |
| InChI | InChI=1S/C12H10ClNO3S/c1-7-2-4-9(11(14-7)12(15)16)17-6-8-3-5-10(13)18-8/h2-5H,6H2,1H3,(H,15,16) |
| InChIKey | ORCBJMSQCKIMMM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |