C25H30N2O8 — CID 118411497
dimethyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-phenylpyridine-2,3-dicarboxylate (PubChem CID 118411497) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is dimethyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-phenylpyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-phenylpyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 118411497 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | dimethyl 5-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-phenylpyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1cc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)c(-c2ccccc2)nc1C(=O)OC |
| InChI | InChI=1S/C25H30N2O8/c1-24(2,3)34-22(30)27(23(31)35-25(4,5)6)17-14-16(20(28)32-7)19(21(29)33-8)26-18(17)15-12-10-9-11-13-15/h9-14H,1-8H3 |
| InChIKey | IMBYRFNKIHODCS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 121.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|