C27H31F3N2O7 — CID 162772708
methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2-prop-2-enylphenoxy)-5-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 162772708) has the molecular formula C27H31F3N2O7 and a molecular weight of 552.55 g/mol. Its IUPAC name is methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2-prop-2-enylphenoxy)-5-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2-prop-2-enylphenoxy)-5-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 162772708 |
| Molecular Formula | C27H31F3N2O7 |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-(2-prop-2-enylphenoxy)-5-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | C=CCc1ccccc1Oc1nc(C(=O)OC)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C27H31F3N2O7/c1-9-12-16-13-10-11-14-19(16)37-21-17(27(28,29)30)15-18(20(31-21)22(33)36-8)32(23(34)38-25(2,3)4)24(35)39-26(5,6)7/h9-11,13-15H,1,12H2,2-8H3 |
| InChIKey | KRRIYOFVEPBWGJ-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|