C27H38F6N2O7Si — CID 169136842
methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(trifluoromethyl)-6-(1,1,1-trifluoro-2-trimethylsilyloxyhex-5-en-2-yl)pyridine-2-carboxylate (PubChem CID 169136842) has the molecular formula C27H38F6N2O7Si and a molecular weight of 644.68 g/mol. Its IUPAC name is methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(trifluoromethyl)-6-(1,1,1-trifluoro-2-trimethylsilyloxyhex-5-en-2-yl)pyridine-2-carboxylate.
| Compound Name | methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(trifluoromethyl)-6-(1,1,1-trifluoro-2-trimethylsilyloxyhex-5-en-2-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 169136842 |
| Molecular Formula | C27H38F6N2O7Si |
| Molecular Weight | 644.68 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-(trifluoromethyl)-6-(1,1,1-trifluoro-2-trimethylsilyloxyhex-5-en-2-yl)pyridine-2-carboxylate |
| SMILES | C=CCCC(O[Si](C)(C)C)(c1nc(C(=O)OC)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H38F6N2O7Si/c1-12-13-14-25(27(31,32)33,42-43(9,10)11)19-16(26(28,29)30)15-17(18(34-19)20(36)39-8)35(21(37)40-23(2,3)4)22(38)41-24(5,6)7/h12,15H,1,13-14H2,2-11H3 |
| InChIKey | PPSVUCPCBUGREN-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 104.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.68 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|