C25H34F3N3O6 — CID 163377274
methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 163377274) has the molecular formula C25H34F3N3O6 and a molecular weight of 529.56 g/mol. Its IUPAC name is methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 163377274 |
| Molecular Formula | C25H34F3N3O6 |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | methyl 3-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | C=CC[C@@H]1CCCN1c1nc(C(=O)OC)c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C25H34F3N3O6/c1-9-11-15-12-10-13-30(15)19-16(25(26,27)28)14-17(18(29-19)20(32)35-8)31(21(33)36-23(2,3)4)22(34)37-24(5,6)7/h9,14-15H,1,10-13H2,2-8H3/t15-/m1/s1 |
| InChIKey | WKJQVPVABOSGPX-OAHLLOKOSA-N |
| XLogP | 6.11 |
| TPSA | 98.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|