C32H40F3N5O5 — CID 163377329
tert-butyl N-[2-[(2-phenylmethoxyhex-5-enoylamino)carbamoyl]-6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate (PubChem CID 163377329) has the molecular formula C32H40F3N5O5 and a molecular weight of 631.70 g/mol. Its IUPAC name is tert-butyl N-[2-[(2-phenylmethoxyhex-5-enoylamino)carbamoyl]-6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[2-[(2-phenylmethoxyhex-5-enoylamino)carbamoyl]-6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 163377329 |
| Molecular Formula | C32H40F3N5O5 |
| Molecular Weight | 631.70 g/mol |
| Exact Mass | 631.30 |
| IUPAC Name | tert-butyl N-[2-[(2-phenylmethoxyhex-5-enoylamino)carbamoyl]-6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)-3-pyridinyl]carbamate |
| SMILES | C=CCCC(OCc1ccccc1)C(=O)NNC(=O)c1nc(N2CCC[C@H]2CC=C)c(C(F)(F)F)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H40F3N5O5/c1-6-8-17-25(44-20-21-14-10-9-11-15-21)28(41)38-39-29(42)26-24(36-30(43)45-31(3,4)5)19-23(32(33,34)35)27(37-26)40-18-12-16-22(40)13-7-2/h6-7,9-11,14-15,19,22,25H,1-2,8,12-13,16-18,20H2,3-5H3,(H,36,43)(H,38,41)(H,39,42)/t22-,25?/m1/s1 |
| InChIKey | DXIRBSVSTZFTGU-UFUCKMQHSA-N |
| XLogP | 6.30 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.70 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|