C33H37F6N5O4 — CID 175456123
[2-methyl-1-[6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)-2-[5-(1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl)-1,3,4-oxadiazol-2-yl]-3-pyridinyl]propan-2-yl]carbamic acid (PubChem CID 175456123) has the molecular formula C33H37F6N5O4 and a molecular weight of 681.68 g/mol. Its IUPAC name is [2-methyl-1-[6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)-2-[5-(1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl)-1,3,4-oxadiazol-2-yl]-3-pyridinyl]propan-2-yl]carbamic acid.
| Compound Name | [2-methyl-1-[6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)-2-[5-(1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl)-1,3,4-oxadiazol-2-yl]-3-pyridinyl]propan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 175456123 |
| Molecular Formula | C33H37F6N5O4 |
| Molecular Weight | 681.68 g/mol |
| Exact Mass | 681.27 |
| IUPAC Name | [2-methyl-1-[6-[(2S)-2-prop-2-enylpyrrolidin-1-yl]-5-(trifluoromethyl)-2-[5-(1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl)-1,3,4-oxadiazol-2-yl]-3-pyridinyl]propan-2-yl]carbamic acid |
| SMILES | C=CCCC(OCc1ccccc1)(c1nnc(-c2nc(N3CCC[C@H]3CC=C)c(C(F)(F)F)cc2CC(C)(C)NC(=O)O)o1)C(F)(F)F |
| InChI | InChI=1S/C33H37F6N5O4/c1-5-7-16-31(33(37,38)39,47-20-21-13-9-8-10-14-21)28-43-42-27(48-28)25-22(19-30(3,4)41-29(45)46)18-24(32(34,35)36)26(40-25)44-17-11-15-23(44)12-6-2/h5-6,8-10,13-14,18,23,41H,1-2,7,11-12,15-17,19-20H2,3-4H3,(H,45,46)/t23-,31?/m1/s1 |
| InChIKey | YTJCYUSZMRPTOR-WNEYBHKTSA-N |
| XLogP | 8.22 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.68 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|