C34H33F6N5O5 — CID 163376942
N-(2-methyl-3-phenylmethoxyhex-5-en-2-yl)-5-nitro-3-(trifluoromethyl)-6-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxypent-4-en-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-2-amine (PubChem CID 163376942) has the molecular formula C34H33F6N5O5 and a molecular weight of 705.66 g/mol. Its IUPAC name is N-(2-methyl-3-phenylmethoxyhex-5-en-2-yl)-5-nitro-3-(trifluoromethyl)-6-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxypent-4-en-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-2-amine.
| Compound Name | N-(2-methyl-3-phenylmethoxyhex-5-en-2-yl)-5-nitro-3-(trifluoromethyl)-6-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxypent-4-en-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 163376942 |
| Molecular Formula | C34H33F6N5O5 |
| Molecular Weight | 705.66 g/mol |
| Exact Mass | 705.24 |
| IUPAC Name | N-(2-methyl-3-phenylmethoxyhex-5-en-2-yl)-5-nitro-3-(trifluoromethyl)-6-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxypent-4-en-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-2-amine |
| SMILES | C=CCC(OCc1ccccc1)C(C)(C)Nc1nc(-c2nnc([C@@](CC=C)(OCc3ccccc3)C(F)(F)F)o2)c([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C34H33F6N5O5/c1-5-13-26(48-20-22-14-9-7-10-15-22)31(3,4)42-28-24(33(35,36)37)19-25(45(46)47)27(41-28)29-43-44-30(50-29)32(18-6-2,34(38,39)40)49-21-23-16-11-8-12-17-23/h5-12,14-17,19,26H,1-2,13,18,20-21H2,3-4H3,(H,41,42)/t26?,32-/m1/s1 |
| InChIKey | TWEJXBUQSBKTDZ-WPNNEGNSSA-N |
| XLogP | 8.96 |
| TPSA | 125.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.66 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|