C29H25F6N7O4 — CID 163376763
5-nitro-N-(1-pyrimidin-2-ylbut-3-enyl)-3-(trifluoromethyl)-6-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-2-amine (PubChem CID 163376763) has the molecular formula C29H25F6N7O4 and a molecular weight of 649.55 g/mol. Its IUPAC name is 5-nitro-N-(1-pyrimidin-2-ylbut-3-enyl)-3-(trifluoromethyl)-6-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-2-amine.
| Compound Name | 5-nitro-N-(1-pyrimidin-2-ylbut-3-enyl)-3-(trifluoromethyl)-6-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 163376763 |
| Molecular Formula | C29H25F6N7O4 |
| Molecular Weight | 649.55 g/mol |
| Exact Mass | 649.19 |
| IUPAC Name | 5-nitro-N-(1-pyrimidin-2-ylbut-3-enyl)-3-(trifluoromethyl)-6-[5-[(2R)-1,1,1-trifluoro-2-phenylmethoxyhex-5-en-2-yl]-1,3,4-oxadiazol-2-yl]pyridin-2-amine |
| SMILES | C=CCC[C@@](OCc1ccccc1)(c1nnc(-c2nc(NC(CC=C)c3ncccn3)c(C(F)(F)F)cc2[N+](=O)[O-])o1)C(F)(F)F |
| InChI | InChI=1S/C29H25F6N7O4/c1-3-5-13-27(29(33,34)35,45-17-18-11-7-6-8-12-18)26-41-40-25(46-26)22-21(42(43)44)16-19(28(30,31)32)23(39-22)38-20(10-4-2)24-36-14-9-15-37-24/h3-4,6-9,11-12,14-16,20H,1-2,5,10,13,17H2,(H,38,39)/t20?,27-/m1/s1 |
| InChIKey | OJILEQQXGQSYPM-MQBBKVSDSA-N |
| XLogP | 7.52 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.55 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|