C34H36F3N5O4Si — CID 175456139
1-[5-[6-[but-3-enyl(methyl)amino]-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazol-2-yl]-1-[tert-butyl(diphenyl)silyl]pent-4-en-2-one (PubChem CID 175456139) has the molecular formula C34H36F3N5O4Si and a molecular weight of 663.77 g/mol. Its IUPAC name is 1-[5-[6-[but-3-enyl(methyl)amino]-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazol-2-yl]-1-[tert-butyl(diphenyl)silyl]pent-4-en-2-one.
| Compound Name | 1-[5-[6-[but-3-enyl(methyl)amino]-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazol-2-yl]-1-[tert-butyl(diphenyl)silyl]pent-4-en-2-one |
|---|---|
| PubChem CID | 175456139 |
| Molecular Formula | C34H36F3N5O4Si |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | 1-[5-[6-[but-3-enyl(methyl)amino]-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazol-2-yl]-1-[tert-butyl(diphenyl)silyl]pent-4-en-2-one |
| SMILES | C=CCCN(C)c1nc(-c2nnc(C(C(=O)CC=C)[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)o2)c([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C34H36F3N5O4Si/c1-7-9-21-41(6)30-25(34(35,36)37)22-26(42(44)45)28(38-30)31-39-40-32(46-31)29(27(43)16-8-2)47(33(3,4)5,23-17-12-10-13-18-23)24-19-14-11-15-20-24/h7-8,10-15,17-20,22,29H,1-2,9,16,21H2,3-6H3 |
| InChIKey | VWPNQYJYAGHTQO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 115.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|