C19H28F3N5O6 — CID 168741108
tert-butyl N-acetyl-N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate (PubChem CID 168741108) has the molecular formula C19H28F3N5O6 and a molecular weight of 479.46 g/mol. Its IUPAC name is tert-butyl N-acetyl-N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-acetyl-N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 168741108 |
| Molecular Formula | C19H28F3N5O6 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | tert-butyl N-acetyl-N-[6-[2-(dimethylamino)ethyl-methylamino]-5-nitro-2-(2,2,2-trifluoroethoxy)-3-pyridinyl]carbamate |
| SMILES | CC(=O)N(C(=O)OC(C)(C)C)c1cc([N+](=O)[O-])c(N(C)CCN(C)C)nc1OCC(F)(F)F |
| InChI | InChI=1S/C19H28F3N5O6/c1-12(28)26(17(29)33-18(2,3)4)14-10-13(27(30)31)15(25(7)9-8-24(5)6)23-16(14)32-11-19(20,21)22/h10H,8-9,11H2,1-7H3 |
| InChIKey | DHYBSTXVYCYJKZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 118.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|