C10H12F3N3O4 — CID 141419227
2-[methyl-[5-nitro-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]ethanol (PubChem CID 141419227) has the molecular formula C10H12F3N3O4 and a molecular weight of 295.22 g/mol. Its IUPAC name is 2-[methyl-[5-nitro-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]ethanol.
| Compound Name | 2-[methyl-[5-nitro-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]ethanol |
|---|---|
| PubChem CID | 141419227 |
| Molecular Formula | C10H12F3N3O4 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-[methyl-[5-nitro-6-(2,2,2-trifluoroethoxy)-2-pyridinyl]amino]ethanol |
| SMILES | CN(CCO)c1ccc([N+](=O)[O-])c(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H12F3N3O4/c1-15(4-5-17)8-3-2-7(16(18)19)9(14-8)20-6-10(11,12)13/h2-3,17H,4-6H2,1H3 |
| InChIKey | UGMDESXYRYGPED-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|